CAS 131076-14-7 appears in our catalog under these names: 4,5-Dimethoxybenzene-1,2-diamine, 95%, 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride, 95%, 1,2–Diamino–4,5–dimethoxybenzene (hydrochloride), 4,5-Dimethoxy-1,2-phenylenediamine hydrochloride, 1,2-Diamino-4,5-dimethoxybenzene HCl 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 100mg, 5g, 250mg, 10g, 1g, 50mg, 2g, 25g.
4,5-dimethoxybenzene-1,2-diamine;dihydrochloride (CAS 131076-14-7) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride. InChIKey: ORAAOAMEUMZGGU-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | ORAAOAMEUMZGGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl.Cl |
Computed by PubChem (NCBI)