CAS 1640848-71-0 appears in our catalog under these names: (R)-2-Amino-2-(6-methoxypyridin-3-yl)ethanol dihydrochloride, 95%, (R)–2–Amino–2–(6–methoxypyridin–3–yl)ethanol dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;dihydrochloride (CAS 1640848-71-0) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: (2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;dihydrochloride. InChIKey: PFYSHCLKSHGDJW-KLXURFKVSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | (2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;dihydrochloride |
| InChIKey | PFYSHCLKSHGDJW-KLXURFKVSA-N |
| SMILES | COC1=NC=C(C=C1)[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)