1,2-Diamino-4,5-dimethoxybenzene (hydrochloride), 98.0%
cas: 131076-14-7 — see every product listed under this CAS number, including other names
1,2-Diamino-4,5-dimethoxybenzene (hydrochloride), 98.0% (CAS 131076-14-7) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 250 mg, 10 g, 100 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W097960-5 g |
| cas | 131076-14-7 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 3166.46 Pln | |
| MedChemExpress | 250 mg | 556.54 Pln | |
| MedChemExpress | 10 g | 5200.54 Pln | |
| MedChemExpress | 100 mg | 375.42 Pln | |
| MedChemExpress | 1 g | 993.07 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
4,5-dimethoxybenzene-1,2-diamine;dihydrochloride (CAS 131076-14-7) is a chemical compound with the molecular formula C8H14Cl2N2O2 and a molecular weight of 241.11 g/mol. IUPAC name: 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride. InChIKey: ORAAOAMEUMZGGU-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2 |
|---|---|
| Molecular weight | 241.11 g/mol |
| IUPAC name | 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride |
| InChIKey | ORAAOAMEUMZGGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
4,5-Dimethoxybenzene-1,2-diamine--hydrogen chloride (1/2), 4,5-dimethoxybenzene-1,2-diamine dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine;dihydrochloride, 1,2-Benzenediamine, 4,5-dimethoxy-, dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine 2HCl, dihydrochlo, 4,5-dimethoxybenzene-1,2-diamine, chloride, chloride, 4,5-Dimethoxy-o-phenylenediamine dihydrochloride, 4,5-dimethoxybenzene-1,2-diamine,dihydrochloride, 1,2-Diamino-4,5-dimethoxybenzene (hydrochloride)