1,2-Dibromo-3,4,5,6-tetramethylbenzene, 95%
cas: 36321-73-0 — see every product listed under this CAS number, including other names
1,2-Dibromo-3,4,5,6-tetramethylbenzene, 95% (CAS 36321-73-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F459064-1G |
| cas | 36321-73-0 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 2653.25 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2706.62 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 554.00 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2985.64 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1,2-dibromo-3,4,5,6-tetramethylbenzene (CAS 36321-73-0) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,2-dibromo-3,4,5,6-tetramethylbenzene. InChIKey: VEZJOZSIGSNYEB-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,2-dibromo-3,4,5,6-tetramethylbenzene |
| InChIKey | VEZJOZSIGSNYEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)Br)Br)C)C |
Computed by PubChem (NCBI)