Products 38108-82-6
CAS 38108-82-6 is the registry number for 2,3-Bis(bromomethyl)-1,4-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,3-bis(bromomethyl)-1,4-dimethylbenzene (CAS 38108-82-6) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 2,3-bis(bromomethyl)-1,4-dimethylbenzene. InChIKey: YCUYSKVWIGHICM-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 2,3-bis(bromomethyl)-1,4-dimethylbenzene |
| InChIKey | YCUYSKVWIGHICM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)CBr)CBr |
Computed by PubChem (NCBI)