CAS 36321-73-0 appears in our catalog under these names: 1,2-Dibromo-3,4,5,6-tetramethylbenzene, 98% , 1,2-Dibromo-3,4,5,6-tetramethylbenzene, 95%, 95%, 1,2-Dibromo-3,4,5,6-tetramethylbenzene, 95%. Offered by: Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,2-dibromo-3,4,5,6-tetramethylbenzene (CAS 36321-73-0) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,2-dibromo-3,4,5,6-tetramethylbenzene. InChIKey: VEZJOZSIGSNYEB-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,2-dibromo-3,4,5,6-tetramethylbenzene |
| InChIKey | VEZJOZSIGSNYEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)Br)Br)C)C |
Computed by PubChem (NCBI)