CAS 73557-66-1 is the registry number for 1,2-Dibromo-4,5-dichlorobenzene, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,2-dibromo-4,5-dichlorobenzene (CAS 73557-66-1) is a chemical compound with the molecular formula C6H2Br2Cl2 and a molecular weight of 304.79 g/mol. IUPAC name: 1,2-dibromo-4,5-dichlorobenzene. InChIKey: XMLDCMHIIUWWPP-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2Cl2 |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 1,2-dibromo-4,5-dichlorobenzene |
| InChIKey | XMLDCMHIIUWWPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)Cl)Cl |
Computed by PubChem (NCBI)