Products 19393-97-6
CAS 19393-97-6 appears in our catalog under these names: 2,5-Dibromo-1,3-dichlorobenzene, ≥95%, ≥95%, 2,5-DIBROMO-1,3-DICHLOROBENZENE, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2,5-dibromo-1,3-dichlorobenzene (CAS 19393-97-6) is a chemical compound with the molecular formula C6H2Br2Cl2 and a molecular weight of 304.79 g/mol. IUPAC name: 2,5-dibromo-1,3-dichlorobenzene. InChIKey: RGZMNZRVGVVRHE-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2Cl2 |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 2,5-dibromo-1,3-dichlorobenzene |
| InChIKey | RGZMNZRVGVVRHE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Br)Cl)Br |
Computed by PubChem (NCBI)