Products 1359986-20-1
CAS 1359986-20-1 appears in our catalog under these names: 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene, 98%, 98%, 1,2-Dibromo-4-methoxy-3,5,6-trimethylbenzene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene (CAS 1359986-20-1) is a chemical compound with the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. IUPAC name: 1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene. InChIKey: OILLOHHJHKICLD-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O |
|---|---|
| Molecular weight | 308.01 g/mol |
| IUPAC name | 1,2-dibromo-4-methoxy-3,5,6-trimethylbenzene |
| InChIKey | OILLOHHJHKICLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1OC)C)Br)Br)C |
Computed by PubChem (NCBI)