CAS 1261988-70-8 is the registry number for 2,4-Dibromo-1-tert-butoxybenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,4-dibromo-1-[(2-methylpropan-2-yl)oxy]benzene (CAS 1261988-70-8) is a chemical compound with the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. IUPAC name: 2,4-dibromo-1-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: VFKZCQTTXZQWAA-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O |
|---|---|
| Molecular weight | 308.01 g/mol |
| IUPAC name | 2,4-dibromo-1-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | VFKZCQTTXZQWAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)