Products 1310416-53-5
CAS 1310416-53-5 appears in our catalog under these names: 1,3-Dibromo-2-isopropoxy-5-methylbenzene, 95+%, 1,3-Dibromo-2-(1-methylethoxy)-5-methylbenzene, 97%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
1,3-dibromo-5-methyl-2-propan-2-yloxybenzene (CAS 1310416-53-5) is a chemical compound with the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. IUPAC name: 1,3-dibromo-5-methyl-2-propan-2-yloxybenzene. InChIKey: CGCHJWUPIIIFGW-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O |
|---|---|
| Molecular weight | 308.01 g/mol |
| IUPAC name | 1,3-dibromo-5-methyl-2-propan-2-yloxybenzene |
| InChIKey | CGCHJWUPIIIFGW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OC(C)C)Br |
Computed by PubChem (NCBI)