CAS 631909-17-6 is the registry number for 1,3-Dibromo-5-(tert-butoxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibromo-5-[(2-methylpropan-2-yl)oxy]benzene (CAS 631909-17-6) is a chemical compound with the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. IUPAC name: 1,3-dibromo-5-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: PFUCEADBYMTDHZ-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2O |
|---|---|
| Molecular weight | 308.01 g/mol |
| IUPAC name | 1,3-dibromo-5-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | PFUCEADBYMTDHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)