cas: 424792-57-4 — see every product listed under this CAS number, including other names
1,2-Difluoro-4-(methylsulfonyl)benzene, 97% (CAS 424792-57-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023629-1G |
| cas | 424792-57-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 299.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1,2-difluoro-4-methylsulfonylbenzene (CAS 424792-57-4) is a chemical compound with the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. IUPAC name: 1,2-difluoro-4-methylsulfonylbenzene. InChIKey: WMBJGJXMKCOHGG-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O2S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 1,2-difluoro-4-methylsulfonylbenzene |
| InChIKey | WMBJGJXMKCOHGG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)