CAS 236739-02-9 is the registry number for 2,4-Difluoro-1-(methylsulfonyl)benzene, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2,4-difluoro-1-methylsulfonylbenzene (CAS 236739-02-9) is a chemical compound with the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. IUPAC name: 2,4-difluoro-1-methylsulfonylbenzene. InChIKey: QERFJRMBVQTJAP-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O2S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 2,4-difluoro-1-methylsulfonylbenzene |
| InChIKey | QERFJRMBVQTJAP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)