CAS 1894823-73-4 appears in our catalog under these names: (2-Fluorophenyl)methanesulfonyl fluoride, (2-fluorophenyl)methanesulfonyl fluoride, 95%, 95%, (2-Fluorophenyl)methanesulfonyl fluoride, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg, 50mg, 100mg, 1g.
(2-fluorophenyl)methanesulfonyl fluoride (CAS 1894823-73-4) is a chemical compound with the molecular formula C7H6F2O2S and a molecular weight of 192.19 g/mol. IUPAC name: (2-fluorophenyl)methanesulfonyl fluoride. InChIKey: UJPGYJAKSFVRGJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F2O2S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | (2-fluorophenyl)methanesulfonyl fluoride |
| InChIKey | UJPGYJAKSFVRGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)F)F |
Computed by PubChem (NCBI)