cas: 13051-19-9 — see every product listed under this CAS number, including other names
1,2-Pyridazinedicarboxylicacid, 3,6-dihydro-, 1,2-bis(1,1-dimethylethyl) ester, 95%, 95% (CAS 13051-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UJ9-100mg |
| cas | 13051-19-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl 3,6-dihydropyridazine-1,2-dicarboxylate (CAS 13051-19-9) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: ditert-butyl 3,6-dihydropyridazine-1,2-dicarboxylate. InChIKey: ZQCNMSTXSXKVNU-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | ditert-butyl 3,6-dihydropyridazine-1,2-dicarboxylate |
| InChIKey | ZQCNMSTXSXKVNU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)