CAS 2805191-50-6 is the registry number for tert-Butyl (2S,6R)-6-formyl-2-isobutyl-3-oxopiperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,6R)-6-formyl-2-(2-methylpropyl)-3-oxopiperazine-1-carboxylate (CAS 2805191-50-6) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: tert-butyl (2S,6R)-6-formyl-2-(2-methylpropyl)-3-oxopiperazine-1-carboxylate. InChIKey: ZXWYNKBMDBHRKK-MNOVXSKESA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | tert-butyl (2S,6R)-6-formyl-2-(2-methylpropyl)-3-oxopiperazine-1-carboxylate |
| InChIKey | ZXWYNKBMDBHRKK-MNOVXSKESA-N |
| SMILES | CC(C)C[C@H]1C(=O)NC[C@@H](N1C(=O)OC(C)(C)C)C=O |
Computed by PubChem (NCBI)