CAS 1365639-13-9 appears in our catalog under these names: 2-Azaspiro[3.3]heptane hemioxalate, 96%, 2-Azaspiro[3.3]heptane, hemioxalate 98%, 2-Azaspiro[3.3]heptane oxalate(2:1), 97%, 97%, 2-Azaspiro[3.3]heptane oxalate(2:1), 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 1g, 5g, 250mg, 100mg, 500mg.
Bis(2-azaspiro[3.3]heptane);oxalic acid (CAS 1365639-13-9) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: bis(2-azaspiro[3.3]heptane);oxalic acid. InChIKey: BNWFMJVKAIJDRK-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | bis(2-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | BNWFMJVKAIJDRK-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CNC2.C1CC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)