CAS 1251012-84-6 is the registry number for Rel-(1r,5s,7s)-6-tert-butyl 7-ethyl 3,6-diazabicyclo[3.2.1]octane-6,7-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-O-tert-butyl 7-O-ethyl (1R,5R,7S)-3,6-diazabicyclo[3.2.1]octane-6,7-dicarboxylate (CAS 1251012-84-6) is a chemical compound with the molecular formula C14H24N2O4 and a molecular weight of 284.35 g/mol. IUPAC name: 6-O-tert-butyl 7-O-ethyl (1R,5R,7S)-3,6-diazabicyclo[3.2.1]octane-6,7-dicarboxylate. InChIKey: IMALXXQBKVAKSL-MXWKQRLJSA-N.
| Molecular formula | C14H24N2O4 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | 6-O-tert-butyl 7-O-ethyl (1R,5R,7S)-3,6-diazabicyclo[3.2.1]octane-6,7-dicarboxylate |
| InChIKey | IMALXXQBKVAKSL-MXWKQRLJSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@@H](N1C(=O)OC(C)(C)C)CNC2 |
Computed by PubChem (NCBI)