cas: 1449586-26-8 — see every product listed under this CAS number, including other names
1,2-Pyrrolidinedicarboxylic acid, 3-cyclohexyl-, 1-(1,1-dimethylethyl) ester, (2R,3R)-rel-, 95%, 95% (CAS 1449586-26-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KDR-25mg |
| cas | 1449586-26-8 |
| size | 25mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 1782.80 Pln | |
| Chemat | 100mg | 4197.20 Pln | |
| Chemat | 250mg | 6952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-3-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1449586-26-8) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: (2R,3R)-3-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: BMRSNFIPEDVKTG-CHWSQXEVSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | (2R,3R)-3-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | BMRSNFIPEDVKTG-CHWSQXEVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H]1C(=O)O)C2CCCCC2 |
Computed by PubChem (NCBI)