cas: 910553-12-7 — see every product listed under this CAS number, including other names
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-methyl-3-thienyl)-, 95+%, 95+% (CAS 910553-12-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GT7P-100mg |
| cas | 910553-12-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1062.80 Pln | |
| Chemat | 5g | 3400.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane (CAS 910553-12-7) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane. InChIKey: YCOQKTIMEQOYNN-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane |
| InChIKey | YCOQKTIMEQOYNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C |
Computed by PubChem (NCBI)