cas: 910553-12-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane 95+% (CAS 910553-12-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A462471-100mg |
| cas | 910553-12-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A462471 |
4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane (CAS 910553-12-7) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane. InChIKey: YCOQKTIMEQOYNN-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane |
| InChIKey | YCOQKTIMEQOYNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C |
Computed by PubChem (NCBI)