cas: 118-12-7 — see every product listed under this CAS number, including other names
1,3,3-Trimethyl-2-methyleneindoline 98% (CAS 118-12-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A374094-5g |
| cas | 118-12-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1093.50 Pln | |
| Ambeed | 1000g | 1799.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A374094 |
1,3,3-trimethyl-2-methylideneindole (CAS 118-12-7) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 1,3,3-trimethyl-2-methylideneindole. InChIKey: ZTUKGBOUHWYFGC-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-methylideneindole |
| InChIKey | ZTUKGBOUHWYFGC-UHFFFAOYSA-N |
| SMILES | CC1(C(=C)N(C2=CC=CC=C21)C)C |
Computed by PubChem (NCBI)