cas: 118-12-7 — see every product listed under this CAS number, including other names
1,3,3-Trimethyl-2-methyleneindoline, >96.0%(GC) (CAS 118-12-7) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 100ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0879-25ML |
| cas | 118-12-7 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 203.43 Pln | |
| TCI | 100ml | 375.53 Pln | |
| TCI | 500ml | 960.68 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
1,3,3-trimethyl-2-methylideneindole (CAS 118-12-7) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 1,3,3-trimethyl-2-methylideneindole. InChIKey: ZTUKGBOUHWYFGC-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 1,3,3-trimethyl-2-methylideneindole |
| InChIKey | ZTUKGBOUHWYFGC-UHFFFAOYSA-N |
| SMILES | CC1(C(=C)N(C2=CC=CC=C21)C)C |
Computed by PubChem (NCBI)