cas: 30363-03-2 — see every product listed under this CAS number, including other names
1,3,5-Triazine,2,4,6-tris(4-bromophenyl)-, 95%, 95% (CAS 30363-03-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZUV-250mg |
| cas | 30363-03-2 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 25g | 323.60 Pln | |
| Chemat | 50g | 587.60 Pln | |
| Chemat | 100g | 1072.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,4,6-tris(4-bromophenyl)-1,3,5-triazine (CAS 30363-03-2) is a chemical compound with the molecular formula C21H12Br3N3 and a molecular weight of 546.1 g/mol. IUPAC name: 2,4,6-tris(4-bromophenyl)-1,3,5-triazine. InChIKey: WZYVDGDZBNQVCF-UHFFFAOYSA-N.
| Molecular formula | C21H12Br3N3 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | 2,4,6-tris(4-bromophenyl)-1,3,5-triazine |
| InChIKey | WZYVDGDZBNQVCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br |
Computed by PubChem (NCBI)