CAS 890148-78-4 appears in our catalog under these names: 2,4,6–Tris(3–bromophenyl)triazine, 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine, >98.0%(HPLC)(N), 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine 95%, 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine, 95%, 95%, 2,4,6-Tris(3-bromophenyl)triazine, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 50g.
2,4,6-tris(3-bromophenyl)-1,3,5-triazine (CAS 890148-78-4) is a chemical compound with the molecular formula C21H12Br3N3 and a molecular weight of 546.1 g/mol. IUPAC name: 2,4,6-tris(3-bromophenyl)-1,3,5-triazine. InChIKey: IWHHYACTSSPXDV-UHFFFAOYSA-N.
| Molecular formula | C21H12Br3N3 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | 2,4,6-tris(3-bromophenyl)-1,3,5-triazine |
| InChIKey | IWHHYACTSSPXDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC(=NC(=N2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br |
Computed by PubChem (NCBI)