CAS 1690315-37-7 appears in our catalog under these names: 2,4,6-Tris(2-bromophenyl)-1,3,5-triazine, 95%, 2,4,6–Tris(2–bromophenyl)–1,3,5–triazine, 2,4,6-Tris(2-bromophenyl)-1,3,5-triazine, 95%, 95%, 2,4,6-Tris(2-bromophenyl)-1,3,5-triazine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2,4,6-tris(2-bromophenyl)-1,3,5-triazine (CAS 1690315-37-7) is a chemical compound with the molecular formula C21H12Br3N3 and a molecular weight of 546.1 g/mol. IUPAC name: 2,4,6-tris(2-bromophenyl)-1,3,5-triazine. InChIKey: CTURUJRMTZHZGM-UHFFFAOYSA-N.
| Molecular formula | C21H12Br3N3 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | 2,4,6-tris(2-bromophenyl)-1,3,5-triazine |
| InChIKey | CTURUJRMTZHZGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NC(=N2)C3=CC=CC=C3Br)C4=CC=CC=C4Br)Br |
Computed by PubChem (NCBI)