CAS 30363-03-2 appears in our catalog under these names: 2,4,6-Tris-(4-bromophenyl)(1,3,5)triazine, 2,4,6–Tris(4–bromophenyl)–1,3,5–triazine, 2,4,6-Tris(4-bromophenyl)-1,3,5-triazine, >98.0%(HPLC)(N), 2,4,6-Tris(4-bromophenyl)-1,3,5-triazine 95%, 1,3,5-Triazine,2,4,6-tris(4-bromophenyl)-, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 2,5g, 250mg, 10g, 25g, 5g, 200mg, 100g.
2,4,6-tris(4-bromophenyl)-1,3,5-triazine (CAS 30363-03-2) is a chemical compound with the molecular formula C21H12Br3N3 and a molecular weight of 546.1 g/mol. IUPAC name: 2,4,6-tris(4-bromophenyl)-1,3,5-triazine. InChIKey: WZYVDGDZBNQVCF-UHFFFAOYSA-N.
| Molecular formula | C21H12Br3N3 |
|---|---|
| Molecular weight | 546.1 g/mol |
| IUPAC name | 2,4,6-tris(4-bromophenyl)-1,3,5-triazine |
| InChIKey | WZYVDGDZBNQVCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br |
Computed by PubChem (NCBI)