cas: 1262412-13-4 — see every product listed under this CAS number, including other names
1,3-Azetidinedicarboxylic acid, 3-amino-, 1-(1,1-dimethylethyl) ester, 97%, 97% (CAS 1262412-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SEY-100mg |
| cas | 1262412-13-4 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2392.40 Pln | |
| Chemat | 10g | 4331.60 Pln | |
| Chemat | 25g | 7989.20 Pln | |
| Chemat | 500mg | 621.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 1262412-13-4) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: 3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: XQGUPRXBCKPKJE-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | XQGUPRXBCKPKJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)O)N |
Computed by PubChem (NCBI)