cas: 1262412-13-4 — see every product listed under this CAS number, including other names
3–Amino–1–((tert–butoxy)carbonyl)azetidine–3–carboxylic acid (CAS 1262412-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB55092-100 |
| cas | 1262412-13-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1154.02 Pln | |
| GLPBio | 1g | 2637.74 Pln | |
| GLPBio | 250mg | 1528.46 Pln | |
| GLPBio | 50mg | 952.76 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 1262412-13-4) is a chemical compound with the molecular formula C9H16N2O4 and a molecular weight of 216.23 g/mol. IUPAC name: 3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: XQGUPRXBCKPKJE-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O4 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | XQGUPRXBCKPKJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)O)N |
Computed by PubChem (NCBI)