cas: 1105663-96-4 — see every product listed under this CAS number, including other names
1,3-Azetidinedicarboxylic acid, 3-cyano-, 1-(1,1-dimethylethyl) 3-ethyl ester, 97%, 97% (CAS 1105663-96-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11073N-100mg |
| cas | 1105663-96-4 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 500mg | 602.00 Pln | |
| Chemat | 1g | 1010.00 Pln | |
| Chemat | 5g | 2901.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate (CAS 1105663-96-4) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate. InChIKey: OZRWQLNFGSPWGB-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-cyanoazetidine-1,3-dicarboxylate |
| InChIKey | OZRWQLNFGSPWGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)C#N |
Computed by PubChem (NCBI)