cas: 888322-11-0 — see every product listed under this CAS number, including other names
1,3-Bis(1,1-dimethylethyl) 2-[6-(bromomethyl)-2-pyridinyl]imidodicarbonate, 96%, 96% (CAS 888322-11-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUVZ-100mg |
| cas | 888322-11-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 5g | 1197.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[6-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 888322-11-0) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-[6-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: RRJIWPFOOZCGAO-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-[6-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | RRJIWPFOOZCGAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=CC(=N1)CBr)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)