CAS 705951-21-9 is the registry number for Di-tert-butyl (4-(bromomethyl)pyridin-2-yl)iminodicarbonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[4-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 705951-21-9) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-[4-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: WWNNNDRTSACBEP-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-[4-(bromomethyl)-2-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | WWNNNDRTSACBEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=CC(=C1)CBr)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)