Products 2803457-06-7
CAS 2803457-06-7 is the registry number for tert-Butyl (5-bromo-6-methylpyridin-3-yl)(tert-butoxycarbonyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(5-bromo-6-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 2803457-06-7) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-(5-bromo-6-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: DRWNVACFYZVGOE-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-6-methyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | DRWNVACFYZVGOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)