cas: 19672-59-4 — see every product listed under this CAS number, including other names
1,3-Bis(4-chlorophenyl)prop-2-en-1-one, 98%(GC-MS),RG, 98%(GC-MS),RG (CAS 19672-59-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOR6-250mg |
| cas | 19672-59-4 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 357.20 Pln |
| purity | 98%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
(E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one (CAS 19672-59-4) is a chemical compound with the molecular formula C15H10Cl2O and a molecular weight of 277.1 g/mol. IUPAC name: (E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one. InChIKey: YMEMCRBNZSLQCQ-XCVCLJGOSA-N.
| Molecular formula | C15H10Cl2O |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | (E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one |
| InChIKey | YMEMCRBNZSLQCQ-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)