CAS 22966-30-9 is the registry number for (E)-1,3-Bis(4-chlorophenyl)prop-2-en-1-one. Offered by: Chemat. Available pack sizes: 1g, 5g.
(E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one (CAS 22966-30-9) is a chemical compound with the molecular formula C15H10Cl2O and a molecular weight of 277.1 g/mol. IUPAC name: (E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one. InChIKey: YMEMCRBNZSLQCQ-XCVCLJGOSA-N.
| Molecular formula | C15H10Cl2O |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | (E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one |
| InChIKey | YMEMCRBNZSLQCQ-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)