Products 1453202-65-7
CAS 1453202-65-7 is the registry number for 1,2-Dichloro-4-((2-ethynylphenoxy)methyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-dichloro-4-[(2-ethynylphenoxy)methyl]benzene (CAS 1453202-65-7) is a chemical compound with the molecular formula C15H10Cl2O and a molecular weight of 277.1 g/mol. IUPAC name: 1,2-dichloro-4-[(2-ethynylphenoxy)methyl]benzene. InChIKey: GZDHLKWISGWFAQ-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 1,2-dichloro-4-[(2-ethynylphenoxy)methyl]benzene |
| InChIKey | GZDHLKWISGWFAQ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=CC=C1OCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)