CAS 1260807-80-4 is the registry number for 2,4-Dichloro-1-(3-ethynyl-phenoxymethyl)-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,4-dichloro-1-[(3-ethynylphenoxy)methyl]benzene (CAS 1260807-80-4) is a chemical compound with the molecular formula C15H10Cl2O and a molecular weight of 277.1 g/mol. IUPAC name: 2,4-dichloro-1-[(3-ethynylphenoxy)methyl]benzene. InChIKey: MQVYHTSEIADBTL-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2O |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | 2,4-dichloro-1-[(3-ethynylphenoxy)methyl]benzene |
| InChIKey | MQVYHTSEIADBTL-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)