cas: 1466-67-7 — see every product listed under this CAS number, including other names
1,3-Dibenzylurea, 97% (CAS 1466-67-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037866-1G |
| cas | 1466-67-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 841.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,3-dibenzylurea (CAS 1466-67-7) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 1,3-dibenzylurea. InChIKey: KATOLVAXCGIBLO-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,3-dibenzylurea |
| InChIKey | KATOLVAXCGIBLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)