CAS 754162-13-5 is the registry number for N-(3-Aminophenyl)-3-phenylpropanamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
N-(3-aminophenyl)-3-phenylpropanamide (CAS 754162-13-5) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: N-(3-aminophenyl)-3-phenylpropanamide. InChIKey: HVIXXESZUFTZMD-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | N-(3-aminophenyl)-3-phenylpropanamide |
| InChIKey | HVIXXESZUFTZMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)NC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)