CAS 5426-73-3 appears in our catalog under these names: 2-Amino-N,3-diphenylpropanamide, 2-Amino-N,3-diphenylpropanamide, 96%, 2-Amino-N,3-diphenylpropanamide, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 10g, 5g, 1g.
2-amino-N,3-diphenylpropanamide (CAS 5426-73-3) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 2-amino-N,3-diphenylpropanamide. InChIKey: DSPLSFBRERHHIN-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-amino-N,3-diphenylpropanamide |
| InChIKey | DSPLSFBRERHHIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)