CAS 35703-71-0 is the registry number for 2-Amino-n-(2,3-dimethylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-N-(2,3-dimethylphenyl)benzamide (CAS 35703-71-0) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 2-amino-N-(2,3-dimethylphenyl)benzamide. InChIKey: HPTLYBZCELMYHK-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 2-amino-N-(2,3-dimethylphenyl)benzamide |
| InChIKey | HPTLYBZCELMYHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2N)C |
Computed by PubChem (NCBI)