cas: 207226-31-1 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-(trifluoromethoxy)benzene 95% (CAS 207226-31-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136720-25g |
| cas | 207226-31-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 298.06 Pln | |
| Ambeed | 500g | 1087.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A136720 |
1,3-dibromo-5-(trifluoromethoxy)benzene (CAS 207226-31-1) is a chemical compound with the molecular formula C7H3Br2F3O and a molecular weight of 319.90 g/mol. IUPAC name: 1,3-dibromo-5-(trifluoromethoxy)benzene. InChIKey: UKHOUWWEEAOCTI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 1,3-dibromo-5-(trifluoromethoxy)benzene |
| InChIKey | UKHOUWWEEAOCTI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)OC(F)(F)F |
Computed by PubChem (NCBI)