1,3-Dibromo-6-chloroimidazo[1,5-a]pyridine, 95%
cas: 1955548-86-3 — see every product listed under this CAS number, including other names
1,3-Dibromo-6-chloroimidazo[1,5-a]pyridine, 95% (CAS 1955548-86-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1085517-250mg |
| cas | 1955548-86-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1099.06 Pln | |
| Ambeed | 1g | 2523.06 Pln | |
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 1014.80 Pln | |
| Chemat | 1g | 2627.60 Pln | |
| BLDpharm | 100mg | 669.79 Pln | |
| BLDpharm | 250mg | 1080.76 Pln | |
| BLDpharm | 1g | 2785.71 Pln | |
| Fluorochem | 100mg | 1143.37 Pln | |
| Fluorochem | 250mg | 1872.28 Pln | |
| Fluorochem | 1g | 4871.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,3-dibromo-6-chloroimidazo[1,5-a]pyridine (CAS 1955548-86-3) is a chemical compound with the molecular formula C7H3Br2ClN2 and a molecular weight of 310.37 g/mol. IUPAC name: 1,3-dibromo-6-chloroimidazo[1,5-a]pyridine. InChIKey: KUMUIJRUVBDCPA-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClN2 |
|---|---|
| Molecular weight | 310.37 g/mol |
| IUPAC name | 1,3-dibromo-6-chloroimidazo[1,5-a]pyridine |
| InChIKey | KUMUIJRUVBDCPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(N2C=C1Cl)Br)Br |
Computed by PubChem (NCBI)