Products 1072944-57-0
CAS 1072944-57-0 appears in our catalog under these names: 3,8-Dibromo-6-chloroimidazo[1,2-a]pyridine, 98%, 3,8-Dibromo-6-chloroimidazo(1,2-a)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
3,8-dibromo-6-chloroimidazo[1,2-a]pyridine (CAS 1072944-57-0) is a chemical compound with the molecular formula C7H3Br2ClN2 and a molecular weight of 310.37 g/mol. IUPAC name: 3,8-dibromo-6-chloroimidazo[1,2-a]pyridine. InChIKey: RZDRXEVTGWJNQY-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClN2 |
|---|---|
| Molecular weight | 310.37 g/mol |
| IUPAC name | 3,8-dibromo-6-chloroimidazo[1,2-a]pyridine |
| InChIKey | RZDRXEVTGWJNQY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2C=C1Cl)Br)Br |
Computed by PubChem (NCBI)