Products 142356-67-0

CAS 142356-67-0 is the registry number for 5,6-dibromo-2-chloro-1H-1,3-benzodiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 10g, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5,6-dibromo-2-chloro-1H-benzimidazole (CAS 142356-67-0) is a chemical compound with the molecular formula C7H3Br2ClN2 and a molecular weight of 310.37 g/mol. IUPAC name: 5,6-dibromo-2-chloro-1H-benzimidazole. InChIKey: ZKYRZYZWRSJKNP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Br2ClN2
Molecular weight310.37 g/mol
IUPAC name5,6-dibromo-2-chloro-1H-benzimidazole
InChIKeyZKYRZYZWRSJKNP-UHFFFAOYSA-N
SMILESC1=C2C(=CC(=C1Br)Br)N=C(N2)Cl

Computed by PubChem (NCBI)