CAS 142356-67-0 is the registry number for 5,6-dibromo-2-chloro-1H-1,3-benzodiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 10g, 250mg, 1g, 5g.
5,6-dibromo-2-chloro-1H-benzimidazole (CAS 142356-67-0) is a chemical compound with the molecular formula C7H3Br2ClN2 and a molecular weight of 310.37 g/mol. IUPAC name: 5,6-dibromo-2-chloro-1H-benzimidazole. InChIKey: ZKYRZYZWRSJKNP-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClN2 |
|---|---|
| Molecular weight | 310.37 g/mol |
| IUPAC name | 5,6-dibromo-2-chloro-1H-benzimidazole |
| InChIKey | ZKYRZYZWRSJKNP-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)N=C(N2)Cl |
Computed by PubChem (NCBI)