Products 16865-06-8
CAS 16865-06-8 is the registry number for 4,7-Dibromo-2-chloro-1H-benzimidazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,7-dibromo-2-chloro-1H-benzimidazole (CAS 16865-06-8) is a chemical compound with the molecular formula C7H3Br2ClN2 and a molecular weight of 310.37 g/mol. IUPAC name: 4,7-dibromo-2-chloro-1H-benzimidazole. InChIKey: JEBCHCXPGQEWLB-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClN2 |
|---|---|
| Molecular weight | 310.37 g/mol |
| IUPAC name | 4,7-dibromo-2-chloro-1H-benzimidazole |
| InChIKey | JEBCHCXPGQEWLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)NC(=N2)Cl)Br |
Computed by PubChem (NCBI)