cas: 401-85-4 — see every product listed under this CAS number, including other names
1,3-Difluoro-5-(trifluoromethyl)benzene 95% (CAS 401-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A825000-1g |
| cas | 401-85-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 5432.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A825000 |
1,3-difluoro-5-(trifluoromethyl)benzene (CAS 401-85-4) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1,3-difluoro-5-(trifluoromethyl)benzene. InChIKey: POCLGXXPDMBMPQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1,3-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | POCLGXXPDMBMPQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(F)(F)F |
Computed by PubChem (NCBI)