cas: 401-85-4 — see every product listed under this CAS number, including other names
1,3-Difluoro-5-(trifluoromethyl)benzene, 95%, 95% (CAS 401-85-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8AK-1g |
| cas | 401-85-4 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 554.00 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 100g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-difluoro-5-(trifluoromethyl)benzene (CAS 401-85-4) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1,3-difluoro-5-(trifluoromethyl)benzene. InChIKey: POCLGXXPDMBMPQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1,3-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | POCLGXXPDMBMPQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(F)(F)F |
Computed by PubChem (NCBI)