CAS 64248-59-5 appears in our catalog under these names: 1,2-Difluoro-3-(trifluoromethyl)benzene 98%, 2,3-Difluorobenzotrifluoride, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
1,2-difluoro-3-(trifluoromethyl)benzene (CAS 64248-59-5) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1,2-difluoro-3-(trifluoromethyl)benzene. InChIKey: CBOJZWDLNLMBLM-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1,2-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | CBOJZWDLNLMBLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(F)(F)F |
Computed by PubChem (NCBI)